C18H26ClN3O3 — CID 174671257
(2R)-1-[6-amino-2-[(4-chlorophenyl)methylamino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 174671257) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is (2R)-1-[6-amino-2-[(4-chlorophenyl)methylamino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[6-amino-2-[(4-chlorophenyl)methylamino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 174671257 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (2R)-1-[6-amino-2-[(4-chlorophenyl)methylamino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCCC(NCc1ccc(Cl)cc1)C(=O)N1CCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C18H26ClN3O3/c19-14-8-6-13(7-9-14)12-21-15(4-1-2-10-20)17(23)22-11-3-5-16(22)18(24)25/h6-9,15-16,21H,1-5,10-12,20H2,(H,24,25)/t15?,16-/m1/s1 |
| InChIKey | VABVYHWFCYYQRA-OEMAIJDKSA-N |
| XLogP | 2.00 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|