About 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine
1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine (PubChem CID 142937073) has the molecular formula C12H24N4O
and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine.
Molecular Properties
| Compound Name | 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine |
| PubChem CID | 142937073 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine |
| SMILES | CCCCN.N#CC1CCCCN1C(=O)CN |
| InChI | InChI=1S/C8H13N3O.C4H11N/c9-5-7-3-1-2-4-11(7)8(12)6-10;1-2-3-4-5/h7H,1-4,6,10H2;2-5H2,1H3 |
| InChIKey | RDOCFSWTQZVQEJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 96.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine?
The IUPAC name of 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine (CID 142937073) is 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine.
What is the SMILES notation for 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine?
The canonical SMILES for 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine is CCCCN.N#CC1CCCCN1C(=O)CN.
What is the InChIKey of 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine?
The InChIKey is RDOCFSWTQZVQEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O.C4H11N/c9-5-7-3-1-2-4-11(7)8(12)6-10;1-2-3-4-5/h7H,1-4,6,10H2;2-5H2,1H3.
What are the key properties of 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine?
1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine has a molecular weight of 240.35 g/mol, XLogP of 0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoacetyl)piperidine-2-carbonitrile;butan-1-amine is sourced from PubChem (CID 142937073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).