C18H33N3O2 — CID 143550252
(3aS,6aR)-2-methoxy-1,2,3,3a,4,5,6,6a-octahydropentalene;1-(2-aminoacetyl)pyrrolidine-2-carbonitrile;ethane (PubChem CID 143550252) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is (3aS,6aR)-2-methoxy-1,2,3,3a,4,5,6,6a-octahydropentalene;1-(2-aminoacetyl)pyrrolidine-2-carbonitrile;ethane.
| Compound Name | (3aS,6aR)-2-methoxy-1,2,3,3a,4,5,6,6a-octahydropentalene;1-(2-aminoacetyl)pyrrolidine-2-carbonitrile;ethane |
|---|---|
| PubChem CID | 143550252 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | (3aS,6aR)-2-methoxy-1,2,3,3a,4,5,6,6a-octahydropentalene;1-(2-aminoacetyl)pyrrolidine-2-carbonitrile;ethane |
| SMILES | CC.COC1C[C@H]2CCC[C@H]2C1.N#CC1CCCN1C(=O)CN |
| InChI | InChI=1S/C9H16O.C7H11N3O.C2H6/c1-10-9-5-7-3-2-4-8(7)6-9;8-4-6-2-1-3-10(6)7(11)5-9;1-2/h7-9H,2-6H2,1H3;6H,1-3,5,9H2;1-2H3/t7-,8+,9?;; |
| InChIKey | JKUUFDUHKZLQEY-XBFJVWQFSA-N |
| XLogP | 2.70 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |