C13H25N3O — CID 142063767
1-[2-(butylamino)acetyl]pyrrolidine-2-carbonitrile;ethane (PubChem CID 142063767) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-[2-(butylamino)acetyl]pyrrolidine-2-carbonitrile;ethane.
| Compound Name | 1-[2-(butylamino)acetyl]pyrrolidine-2-carbonitrile;ethane |
|---|---|
| PubChem CID | 142063767 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 1-[2-(butylamino)acetyl]pyrrolidine-2-carbonitrile;ethane |
| SMILES | CC.CCCCNCC(=O)N1CCCC1C#N |
| InChI | InChI=1S/C11H19N3O.C2H6/c1-2-3-6-13-9-11(15)14-7-4-5-10(14)8-12;1-2/h10,13H,2-7,9H2,1H3;1-2H3 |
| InChIKey | JXDWPSKHKRHTMY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|