C17H26N4O2 — CID 66763203
N-methylmethanamine;(2S)-1-[2-(2-phenoxyethylamino)acetyl]pyrrolidine-2-carbonitrile (PubChem CID 66763203) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-methylmethanamine;(2S)-1-[2-(2-phenoxyethylamino)acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | N-methylmethanamine;(2S)-1-[2-(2-phenoxyethylamino)acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 66763203 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-methylmethanamine;(2S)-1-[2-(2-phenoxyethylamino)acetyl]pyrrolidine-2-carbonitrile |
| SMILES | CNC.N#C[C@@H]1CCCN1C(=O)CNCCOc1ccccc1 |
| InChI | InChI=1S/C15H19N3O2.C2H7N/c16-11-13-5-4-9-18(13)15(19)12-17-8-10-20-14-6-2-1-3-7-14;1-3-2/h1-3,6-7,13,17H,4-5,8-10,12H2;3H,1-2H3/t13-;/m0./s1 |
| InChIKey | PEZGMGMHHDKAAL-ZOWNYOTGSA-N |
| XLogP | 1.01 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|