C21H25N5O2 — CID 22563384
1-[2-[2-[[6-(3-methoxyphenyl)-2-pyridinyl]amino]ethylamino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 22563384) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[2-[2-[[6-(3-methoxyphenyl)-2-pyridinyl]amino]ethylamino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | 1-[2-[2-[[6-(3-methoxyphenyl)-2-pyridinyl]amino]ethylamino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 22563384 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-[2-[2-[[6-(3-methoxyphenyl)-2-pyridinyl]amino]ethylamino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | COc1cccc(-c2cccc(NCCNCC(=O)N3CCCC3C#N)n2)c1 |
| InChI | InChI=1S/C21H25N5O2/c1-28-18-7-2-5-16(13-18)19-8-3-9-20(25-19)24-11-10-23-15-21(27)26-12-4-6-17(26)14-22/h2-3,5,7-9,13,17,23H,4,6,10-12,15H2,1H3,(H,24,25) |
| InChIKey | YSJNARLKNAZFDL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|