C19H26N4O2 — CID 68684792
3-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]-N-(2-phenylpropan-2-yl)propanamide (PubChem CID 68684792) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]-N-(2-phenylpropan-2-yl)propanamide.
| Compound Name | 3-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]-N-(2-phenylpropan-2-yl)propanamide |
|---|---|
| PubChem CID | 68684792 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 3-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]-N-(2-phenylpropan-2-yl)propanamide |
| SMILES | CC(C)(NC(=O)CCNCC(=O)N1CCCC1C#N)c1ccccc1 |
| InChI | InChI=1S/C19H26N4O2/c1-19(2,15-7-4-3-5-8-15)22-17(24)10-11-21-14-18(25)23-12-6-9-16(23)13-20/h3-5,7-8,16,21H,6,9-12,14H2,1-2H3,(H,22,24) |
| InChIKey | XUDJEDOIMGXNTK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|