C20H26ClN5O2 — CID 174718999
1-[2-[2-[2-oxo-3-(2-phenylethyl)imidazol-1-yl]ethylamino]acetyl]pyrrolidine-2-carbonitrile;hydrochloride (PubChem CID 174718999) has the molecular formula C20H26ClN5O2 and a molecular weight of 403.91 g/mol. Its IUPAC name is 1-[2-[2-[2-oxo-3-(2-phenylethyl)imidazol-1-yl]ethylamino]acetyl]pyrrolidine-2-carbonitrile;hydrochloride.
| Compound Name | 1-[2-[2-[2-oxo-3-(2-phenylethyl)imidazol-1-yl]ethylamino]acetyl]pyrrolidine-2-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 174718999 |
| Molecular Formula | C20H26ClN5O2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-[2-[2-[2-oxo-3-(2-phenylethyl)imidazol-1-yl]ethylamino]acetyl]pyrrolidine-2-carbonitrile;hydrochloride |
| SMILES | Cl.N#CC1CCCN1C(=O)CNCCn1ccn(CCc2ccccc2)c1=O |
| InChI | InChI=1S/C20H25N5O2.ClH/c21-15-18-7-4-10-25(18)19(26)16-22-9-12-24-14-13-23(20(24)27)11-8-17-5-2-1-3-6-17;/h1-3,5-6,13-14,18,22H,4,7-12,16H2;1H |
| InChIKey | SYVDZFBWSCOHOQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|