C17H19ClN4O — CID 66763237
(2S)-1-[2-[2-(4-chloroindol-1-yl)ethylamino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 66763237) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is (2S)-1-[2-[2-(4-chloroindol-1-yl)ethylamino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[2-[2-(4-chloroindol-1-yl)ethylamino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 66763237 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (2S)-1-[2-[2-(4-chloroindol-1-yl)ethylamino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNCCn1ccc2c(Cl)cccc21 |
| InChI | InChI=1S/C17H19ClN4O/c18-15-4-1-5-16-14(15)6-9-21(16)10-7-20-12-17(23)22-8-2-3-13(22)11-19/h1,4-6,9,13,20H,2-3,7-8,10,12H2/t13-/m0/s1 |
| InChIKey | IXXKHFCNKDPOQL-ZDUSSCGKSA-N |
| XLogP | 2.40 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|