C8H11N3O2 — CID 138723008
N-[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]formamide (PubChem CID 138723008) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is N-[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]formamide.
| Compound Name | N-[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]formamide |
|---|---|
| PubChem CID | 138723008 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]formamide |
| SMILES | N#CC1CCCN1C(=O)CNC=O |
| InChI | InChI=1S/C8H11N3O2/c9-4-7-2-1-3-11(7)8(13)5-10-6-12/h6-7H,1-3,5H2,(H,10,12) |
| InChIKey | HUWQVNDXMIQUHX-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|