C23H32N3O4P — CID 10052311
(2S)-2,6-diamino-1-(2-diphenoxyphosphorylpiperidin-1-yl)hexan-1-one (PubChem CID 10052311) has the molecular formula C23H32N3O4P and a molecular weight of 445.50 g/mol. Its IUPAC name is (2S)-2,6-diamino-1-(2-diphenoxyphosphorylpiperidin-1-yl)hexan-1-one.
| Compound Name | (2S)-2,6-diamino-1-(2-diphenoxyphosphorylpiperidin-1-yl)hexan-1-one |
|---|---|
| PubChem CID | 10052311 |
| Molecular Formula | C23H32N3O4P |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (2S)-2,6-diamino-1-(2-diphenoxyphosphorylpiperidin-1-yl)hexan-1-one |
| SMILES | NCCCC[C@H](N)C(=O)N1CCCCC1P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C23H32N3O4P/c24-17-9-7-15-21(25)23(27)26-18-10-8-16-22(26)31(28,29-19-11-3-1-4-12-19)30-20-13-5-2-6-14-20/h1-6,11-14,21-22H,7-10,15-18,24-25H2/t21-,22?/m0/s1 |
| InChIKey | XHZYTYJPCRJKHV-HMTLIYDFSA-N |
| XLogP | 4.13 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|