C19H28N4O4 — CID 67393156
4-benzamido-1-(2,6-diaminohexanoyl)piperidine-2-carboxylic acid (PubChem CID 67393156) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-benzamido-1-(2,6-diaminohexanoyl)piperidine-2-carboxylic acid.
| Compound Name | 4-benzamido-1-(2,6-diaminohexanoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67393156 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 4-benzamido-1-(2,6-diaminohexanoyl)piperidine-2-carboxylic acid |
| SMILES | NCCCCC(N)C(=O)N1CCC(NC(=O)c2ccccc2)CC1C(=O)O |
| InChI | InChI=1S/C19H28N4O4/c20-10-5-4-8-15(21)18(25)23-11-9-14(12-16(23)19(26)27)22-17(24)13-6-2-1-3-7-13/h1-3,6-7,14-16H,4-5,8-12,20-21H2,(H,22,24)(H,26,27) |
| InChIKey | HLRNQFYUVDTBEB-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|