C24H33N5O2 — CID 123233859
1-(2,6-diaminohexanoyl)-N-(1-phenyl-2-pyridin-2-ylethyl)pyrrolidine-2-carboxamide (PubChem CID 123233859) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 1-(2,6-diaminohexanoyl)-N-(1-phenyl-2-pyridin-2-ylethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2,6-diaminohexanoyl)-N-(1-phenyl-2-pyridin-2-ylethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123233859 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 1-(2,6-diaminohexanoyl)-N-(1-phenyl-2-pyridin-2-ylethyl)pyrrolidine-2-carboxamide |
| SMILES | NCCCCC(N)C(=O)N1CCCC1C(=O)NC(Cc1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C24H33N5O2/c25-14-6-4-12-20(26)24(31)29-16-8-13-22(29)23(30)28-21(18-9-2-1-3-10-18)17-19-11-5-7-15-27-19/h1-3,5,7,9-11,15,20-22H,4,6,8,12-14,16-17,25-26H2,(H,28,30) |
| InChIKey | BEEHQODUONYQIO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|