C28H39ClN4O5 — CID 131714199
(2S)-1-[(2S)-6-amino-2-[[(3S)-3-benzamido-2-hydroxy-4-phenylbutyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 131714199) has the molecular formula C28H39ClN4O5 and a molecular weight of 547.10 g/mol. Its IUPAC name is (2S)-1-[(2S)-6-amino-2-[[(3S)-3-benzamido-2-hydroxy-4-phenylbutyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid;hydrochloride.
| Compound Name | (2S)-1-[(2S)-6-amino-2-[[(3S)-3-benzamido-2-hydroxy-4-phenylbutyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 131714199 |
| Molecular Formula | C28H39ClN4O5 |
| Molecular Weight | 547.10 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | (2S)-1-[(2S)-6-amino-2-[[(3S)-3-benzamido-2-hydroxy-4-phenylbutyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| SMILES | Cl.NCCCC[C@H](NCC(O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C28H38N4O5.ClH/c29-16-8-7-14-22(27(35)32-17-9-15-24(32)28(36)37)30-19-25(33)23(18-20-10-3-1-4-11-20)31-26(34)21-12-5-2-6-13-21;/h1-6,10-13,22-25,30,33H,7-9,14-19,29H2,(H,31,34)(H,36,37);1H/t22-,23-,24-,25?;/m0./s1 |
| InChIKey | PLFHFCJGOOZZFK-QSECIODCSA-N |
| XLogP | 1.97 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.10 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|