C28H29Cl2N2O6P — CID 10438404
benzyl N-[(2S)-1-[2-bis(4-chlorophenoxy)phosphorylpiperidin-1-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 10438404) has the molecular formula C28H29Cl2N2O6P and a molecular weight of 591.43 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[2-bis(4-chlorophenoxy)phosphorylpiperidin-1-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[2-bis(4-chlorophenoxy)phosphorylpiperidin-1-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10438404 |
| Molecular Formula | C28H29Cl2N2O6P |
| Molecular Weight | 591.43 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | benzyl N-[(2S)-1-[2-bis(4-chlorophenoxy)phosphorylpiperidin-1-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCCCC1P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H29Cl2N2O6P/c1-20(31-28(34)36-19-21-7-3-2-4-8-21)27(33)32-18-6-5-9-26(32)39(35,37-24-14-10-22(29)11-15-24)38-25-16-12-23(30)13-17-25/h2-4,7-8,10-17,20,26H,5-6,9,18-19H2,1H3,(H,31,34)/t20-,26?/m0/s1 |
| InChIKey | DWKPTEANHNSQTQ-DQUNLGLBSA-N |
| XLogP | 7.30 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.43 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|