C19H23N2O4P — CID 19431376
2-amino-1-(2-diphenoxyphosphorylpyrrolidin-1-yl)propan-1-one (PubChem CID 19431376) has the molecular formula C19H23N2O4P and a molecular weight of 374.38 g/mol. Its IUPAC name is 2-amino-1-(2-diphenoxyphosphorylpyrrolidin-1-yl)propan-1-one.
| Compound Name | 2-amino-1-(2-diphenoxyphosphorylpyrrolidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 19431376 |
| Molecular Formula | C19H23N2O4P |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-amino-1-(2-diphenoxyphosphorylpyrrolidin-1-yl)propan-1-one |
| SMILES | CC(N)C(=O)N1CCCC1P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C19H23N2O4P/c1-15(20)19(22)21-14-8-13-18(21)26(23,24-16-9-4-2-5-10-16)25-17-11-6-3-7-12-17/h2-7,9-12,15,18H,8,13-14,20H2,1H3 |
| InChIKey | BLSRGJPGRJBHQK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|