C17H25N2O5P — CID 24827308
(2S)-2-[[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidin-2-yl]-hydroxyphosphoryl]methyl]-3-phenylpropanoic acid (PubChem CID 24827308) has the molecular formula C17H25N2O5P and a molecular weight of 368.37 g/mol. Its IUPAC name is (2S)-2-[[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidin-2-yl]-hydroxyphosphoryl]methyl]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidin-2-yl]-hydroxyphosphoryl]methyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 24827308 |
| Molecular Formula | C17H25N2O5P |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (2S)-2-[[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidin-2-yl]-hydroxyphosphoryl]methyl]-3-phenylpropanoic acid |
| SMILES | C[C@H](N)C(=O)N1CCC[C@@H]1P(=O)(O)C[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H25N2O5P/c1-12(18)16(20)19-9-5-8-15(19)25(23,24)11-14(17(21)22)10-13-6-3-2-4-7-13/h2-4,6-7,12,14-15H,5,8-11,18H2,1H3,(H,21,22)(H,23,24)/t12-,14+,15-/m0/s1 |
| InChIKey | FXKVWUVDPNZKLS-CFVMTHIKSA-N |
| XLogP | 1.50 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|