C22H29N2O4P — CID 85115600
2-amino-1-(2-diphenoxyphosphorylpyrrolidin-1-yl)-3-methylpentan-1-one (PubChem CID 85115600) has the molecular formula C22H29N2O4P and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-amino-1-(2-diphenoxyphosphorylpyrrolidin-1-yl)-3-methylpentan-1-one.
| Compound Name | 2-amino-1-(2-diphenoxyphosphorylpyrrolidin-1-yl)-3-methylpentan-1-one |
|---|---|
| PubChem CID | 85115600 |
| Molecular Formula | C22H29N2O4P |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2-amino-1-(2-diphenoxyphosphorylpyrrolidin-1-yl)-3-methylpentan-1-one |
| SMILES | CCC(C)C(N)C(=O)N1CCCC1P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C22H29N2O4P/c1-3-17(2)21(23)22(25)24-16-10-15-20(24)29(26,27-18-11-6-4-7-12-18)28-19-13-8-5-9-14-19/h4-9,11-14,17,20-21H,3,10,15-16,23H2,1-2H3 |
| InChIKey | KIDDMZJRFUKWAI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|