C15H23N3O — CID 177313207
(2S)-2,6-diamino-1-[(2R,3R)-2-methyl-3-phenylaziridin-1-yl]hexan-1-one (PubChem CID 177313207) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is (2S)-2,6-diamino-1-[(2R,3R)-2-methyl-3-phenylaziridin-1-yl]hexan-1-one.
| Compound Name | (2S)-2,6-diamino-1-[(2R,3R)-2-methyl-3-phenylaziridin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 177313207 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | (2S)-2,6-diamino-1-[(2R,3R)-2-methyl-3-phenylaziridin-1-yl]hexan-1-one |
| SMILES | C[C@@H]1[C@@H](c2ccccc2)N1C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C15H23N3O/c1-11-14(12-7-3-2-4-8-12)18(11)15(19)13(17)9-5-6-10-16/h2-4,7-8,11,13-14H,5-6,9-10,16-17H2,1H3/t11-,13+,14+,18?/m1/s1 |
| InChIKey | OKMYOHUIBSOQFR-UXNJEDLSSA-N |
| XLogP | 1.41 |
| TPSA | 72.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|