C12H21N5O3 — CID 57301212
(2S)-2-amino-3-[1-[(2S)-2,6-diaminohexanoyl]imidazol-4-yl]propanoic acid (PubChem CID 57301212) has the molecular formula C12H21N5O3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (2S)-2-amino-3-[1-[(2S)-2,6-diaminohexanoyl]imidazol-4-yl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[1-[(2S)-2,6-diaminohexanoyl]imidazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 57301212 |
| Molecular Formula | C12H21N5O3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2S)-2-amino-3-[1-[(2S)-2,6-diaminohexanoyl]imidazol-4-yl]propanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)n1cnc(C[C@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C12H21N5O3/c13-4-2-1-3-9(14)11(18)17-6-8(16-7-17)5-10(15)12(19)20/h6-7,9-10H,1-5,13-15H2,(H,19,20)/t9-,10-/m0/s1 |
| InChIKey | CSFOHLSNGNVXMP-UWVGGRQHSA-N |
| XLogP | -1.07 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|