C8H11ClLiNO3 — CID 142547749
lithium (2R)-1-[(2R)-2-chloropropanoyl]pyrrolidine-2-carboxylate (PubChem CID 142547749) has the molecular formula C8H11ClLiNO3 and a molecular weight of 211.57 g/mol. Its IUPAC name is lithium (2R)-1-[(2R)-2-chloropropanoyl]pyrrolidine-2-carboxylate.
| Compound Name | lithium (2R)-1-[(2R)-2-chloropropanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 142547749 |
| Molecular Formula | C8H11ClLiNO3 |
| Molecular Weight | 211.57 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | lithium (2R)-1-[(2R)-2-chloropropanoyl]pyrrolidine-2-carboxylate |
| SMILES | C[C@@H](Cl)C(=O)N1CCC[C@@H]1C(=O)[O-].[Li+] |
| InChI | InChI=1S/C8H12ClNO3.Li/c1-5(9)7(11)10-4-2-3-6(10)8(12)13;/h5-6H,2-4H2,1H3,(H,12,13);/q;+1/p-1/t5-,6-;/m1./s1 |
| InChIKey | NJMYCISLOULNTL-KGZKBUQUSA-M |
| XLogP | -3.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.57 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|