C10H17KN2O5S — CID 23715032
potassium (2S)-1-[(2S)-2-(ethylsulfonylamino)propanoyl]pyrrolidine-2-carboxylate (PubChem CID 23715032) has the molecular formula C10H17KN2O5S and a molecular weight of 316.42 g/mol. Its IUPAC name is potassium (2S)-1-[(2S)-2-(ethylsulfonylamino)propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | potassium (2S)-1-[(2S)-2-(ethylsulfonylamino)propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 23715032 |
| Molecular Formula | C10H17KN2O5S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | potassium (2S)-1-[(2S)-2-(ethylsulfonylamino)propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCS(=O)(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)[O-].[K+] |
| InChI | InChI=1S/C10H18N2O5S.K/c1-3-18(16,17)11-7(2)9(13)12-6-4-5-8(12)10(14)15;/h7-8,11H,3-6H2,1-2H3,(H,14,15);/q;+1/p-1/t7-,8-;/m0./s1 |
| InChIKey | ZNACTUAZAATDSV-WSZWBAFRSA-M |
| XLogP | -4.94 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | -4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |