C10H15N2O3- — CID 132526338
(2R)-1-[(2R)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 132526338) has the molecular formula C10H15N2O3- and a molecular weight of 211.24 g/mol. Its IUPAC name is (2R)-1-[(2R)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | (2R)-1-[(2R)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 132526338 |
| Molecular Formula | C10H15N2O3- |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | (2R)-1-[(2R)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCN1C(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C10H16N2O3/c13-9(7-3-1-5-11-7)12-6-2-4-8(12)10(14)15/h7-8,11H,1-6H2,(H,14,15)/p-1/t7-,8-/m1/s1 |
| InChIKey | RWCOTTLHDJWHRS-HTQZYQBOSA-M |
| XLogP | -1.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |