C10H17AsN2O2 — CID 173334366
(2-arsanylcarbonylpyrrolidin-1-yl)-pyrrolidin-2-ylmethanone (PubChem CID 173334366) has the molecular formula C10H17AsN2O2 and a molecular weight of 272.18 g/mol. Its IUPAC name is (2-arsanylcarbonylpyrrolidin-1-yl)-pyrrolidin-2-ylmethanone.
| Compound Name | (2-arsanylcarbonylpyrrolidin-1-yl)-pyrrolidin-2-ylmethanone |
|---|---|
| PubChem CID | 173334366 |
| Molecular Formula | C10H17AsN2O2 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (2-arsanylcarbonylpyrrolidin-1-yl)-pyrrolidin-2-ylmethanone |
| SMILES | O=C([AsH2])C1CCCN1C(=O)C1CCCN1 |
| InChI | InChI=1S/C10H17AsN2O2/c11-9(14)8-4-2-6-13(8)10(15)7-3-1-5-12-7/h7-8,12H,1-6,11H2 |
| InChIKey | SYBZDXURNITJGH-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|