C11H18N2O3 — CID 78923169
(2R)-1-(piperidine-2-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 78923169) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is (2R)-1-(piperidine-2-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-(piperidine-2-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 78923169 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (2R)-1-(piperidine-2-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1C(=O)C1CCCCN1 |
| InChI | InChI=1S/C11H18N2O3/c14-10(8-4-1-2-6-12-8)13-7-3-5-9(13)11(15)16/h8-9,12H,1-7H2,(H,15,16)/t8?,9-/m1/s1 |
| InChIKey | GVGLBBTVAMQYCG-YGPZHTELSA-N |
| XLogP | 0.20 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |