C9H14Cl2O — CID 45081064
2,2-dichloro-1-cycloheptylethanone (PubChem CID 45081064) has the molecular formula C9H14Cl2O and a molecular weight of 209.12 g/mol. Its IUPAC name is 2,2-dichloro-1-cycloheptylethanone.
| Compound Name | 2,2-dichloro-1-cycloheptylethanone |
|---|---|
| PubChem CID | 45081064 |
| Molecular Formula | C9H14Cl2O |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 2,2-dichloro-1-cycloheptylethanone |
| SMILES | O=C(C(Cl)Cl)C1CCCCCC1 |
| InChI | InChI=1S/C9H14Cl2O/c10-9(11)8(12)7-5-3-1-2-4-6-7/h7,9H,1-6H2 |
| InChIKey | LMUWUXGRZBZMJM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|