C16H32O — CID 143362777
1-cyclohexyl-2,3-dimethylbutan-1-one;ethane;ethene (PubChem CID 143362777) has the molecular formula C16H32O and a molecular weight of 240.43 g/mol. Its IUPAC name is 1-cyclohexyl-2,3-dimethylbutan-1-one;ethane;ethene.
| Compound Name | 1-cyclohexyl-2,3-dimethylbutan-1-one;ethane;ethene |
|---|---|
| PubChem CID | 143362777 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | 1-cyclohexyl-2,3-dimethylbutan-1-one;ethane;ethene |
| SMILES | C=C.CC.CC(C)C(C)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C12H22O.C2H6.C2H4/c1-9(2)10(3)12(13)11-7-5-4-6-8-11;2*1-2/h9-11H,4-8H2,1-3H3;1-2H3;1-2H2 |
| InChIKey | NXRFYWOIWLZNDF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|