C8H14OS2 — CID 87477865
1-cyclohexyl-2,2-bis(sulfanyl)ethanone (PubChem CID 87477865) has the molecular formula C8H14OS2 and a molecular weight of 190.33 g/mol. Its IUPAC name is 1-cyclohexyl-2,2-bis(sulfanyl)ethanone.
| Compound Name | 1-cyclohexyl-2,2-bis(sulfanyl)ethanone |
|---|---|
| PubChem CID | 87477865 |
| Molecular Formula | C8H14OS2 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 1-cyclohexyl-2,2-bis(sulfanyl)ethanone |
| SMILES | O=C(C(S)S)C1CCCCC1 |
| InChI | InChI=1S/C8H14OS2/c9-7(8(10)11)6-4-2-1-3-5-6/h6,8,10-11H,1-5H2 |
| InChIKey | WMDDECTUXCNWAJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|