About bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium
bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium (PubChem CID 173239704) has the molecular formula C16H28Cl2N2O2Ti-2
and a molecular weight of 399.19 g/mol. Its IUPAC name is bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium.
Molecular Properties
| Compound Name | bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium |
| PubChem CID | 173239704 |
| Molecular Formula | C16H28Cl2N2O2Ti-2 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium |
| SMILES | C[N-]C(=O)C1CCCCC1.C[N-]C(=O)C1CCCCC1.Cl[Ti]Cl |
| InChI | InChI=1S/2C8H15NO.2ClH.Ti/c2*1-9-8(10)7-5-3-2-4-6-7;;;/h2*7H,2-6H2,1H3,(H,9,10);2*1H;/q;;;;+2/p-4 |
| InChIKey | NVPVJSYYKZNJFL-UHFFFAOYSA-J |
| XLogP | 5.57 |
| TPSA | 62.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium?
The IUPAC name of bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium (CID 173239704) is bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium.
What is the SMILES notation for bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium?
The canonical SMILES for bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium is C[N-]C(=O)C1CCCCC1.C[N-]C(=O)C1CCCCC1.Cl[Ti]Cl.
What is the InChIKey of bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium?
The InChIKey is NVPVJSYYKZNJFL-UHFFFAOYSA-J. The full InChI is InChI=1S/2C8H15NO.2ClH.Ti/c2*1-9-8(10)7-5-3-2-4-6-7;;;/h2*7H,2-6H2,1H3,(H,9,10);2*1H;/q;;;;+2/p-4.
What are the key properties of bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium?
bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium has a molecular weight of 399.19 g/mol, XLogP of 5.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclohexanecarbonyl(methyl)azanide);dichlorotitanium is sourced from PubChem (CID 173239704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).