C13H23N — CID 155692364
ethane;2-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyrrolidine (PubChem CID 155692364) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is ethane;2-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyrrolidine.
| Compound Name | ethane;2-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyrrolidine |
|---|---|
| PubChem CID | 155692364 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | ethane;2-[(3E)-4-methylhexa-1,3,5-trien-3-yl]pyrrolidine |
| SMILES | C=C/C(C)=C(\C=C)C1CCCN1.CC |
| InChI | InChI=1S/C11H17N.C2H6/c1-4-9(3)10(5-2)11-7-6-8-12-11;1-2/h4-5,11-12H,1-2,6-8H2,3H3;1-2H3/b10-9+; |
| InChIKey | GCTVXEWZNXSEAG-RRABGKBLSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|