C10H14ClN — CID 172597875
2-[(3Z)-4-chlorohexa-1,3,5-trien-3-yl]pyrrolidine (PubChem CID 172597875) has the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. Its IUPAC name is 2-[(3Z)-4-chlorohexa-1,3,5-trien-3-yl]pyrrolidine.
| Compound Name | 2-[(3Z)-4-chlorohexa-1,3,5-trien-3-yl]pyrrolidine |
|---|---|
| PubChem CID | 172597875 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-[(3Z)-4-chlorohexa-1,3,5-trien-3-yl]pyrrolidine |
| SMILES | C=C/C(Cl)=C(\C=C)C1CCCN1 |
| InChI | InChI=1S/C10H14ClN/c1-3-8(9(11)4-2)10-6-5-7-12-10/h3-4,10,12H,1-2,5-7H2/b9-8- |
| InChIKey | QDTNLMJNRZTMEE-HJWRWDBZSA-N |
| XLogP | 2.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|