C7H11N — CID 143075813
2-buta-1,3-dien-2-ylazetidine (PubChem CID 143075813) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-ylazetidine.
| Compound Name | 2-buta-1,3-dien-2-ylazetidine |
|---|---|
| PubChem CID | 143075813 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 2-buta-1,3-dien-2-ylazetidine |
| SMILES | C=CC(=C)C1CCN1 |
| InChI | InChI=1S/C7H11N/c1-3-6(2)7-4-5-8-7/h3,7-8H,1-2,4-5H2 |
| InChIKey | GSRPXWKCMQZIPH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|