C12H17ClFN — CID 175631411
(2S)-2-[(3E,5E)-4-chloro-5-fluorohepta-1,3,5-trien-2-yl]piperidine (PubChem CID 175631411) has the molecular formula C12H17ClFN and a molecular weight of 229.73 g/mol. Its IUPAC name is (2S)-2-[(3E,5E)-4-chloro-5-fluorohepta-1,3,5-trien-2-yl]piperidine.
| Compound Name | (2S)-2-[(3E,5E)-4-chloro-5-fluorohepta-1,3,5-trien-2-yl]piperidine |
|---|---|
| PubChem CID | 175631411 |
| Molecular Formula | C12H17ClFN |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (2S)-2-[(3E,5E)-4-chloro-5-fluorohepta-1,3,5-trien-2-yl]piperidine |
| SMILES | C=C(/C=C(Cl)\C(F)=C/C)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C12H17ClFN/c1-3-11(14)10(13)8-9(2)12-6-4-5-7-15-12/h3,8,12,15H,2,4-7H2,1H3/b10-8+,11-3+/t12-/m0/s1 |
| InChIKey | PMBLIBXSXGGURD-BCQYVZLYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|