C12H16ClF2N — CID 175629680
(2S)-2-[(3E,5Z)-6-chloro-4,5-difluorohepta-1,3,5-trien-2-yl]piperidine (PubChem CID 175629680) has the molecular formula C12H16ClF2N and a molecular weight of 247.72 g/mol. Its IUPAC name is (2S)-2-[(3E,5Z)-6-chloro-4,5-difluorohepta-1,3,5-trien-2-yl]piperidine.
| Compound Name | (2S)-2-[(3E,5Z)-6-chloro-4,5-difluorohepta-1,3,5-trien-2-yl]piperidine |
|---|---|
| PubChem CID | 175629680 |
| Molecular Formula | C12H16ClF2N |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | (2S)-2-[(3E,5Z)-6-chloro-4,5-difluorohepta-1,3,5-trien-2-yl]piperidine |
| SMILES | C=C(/C=C(F)\C(F)=C(/C)Cl)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C12H16ClF2N/c1-8(11-5-3-4-6-16-11)7-10(14)12(15)9(2)13/h7,11,16H,1,3-6H2,2H3/b10-7+,12-9-/t11-/m0/s1 |
| InChIKey | XABKJCUHBYAHEI-IKMUYMICSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|