C7H11NO2 — CID 70487851
2-(azetidin-2-yl)but-2-enoic acid (PubChem CID 70487851) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-(azetidin-2-yl)but-2-enoic acid.
| Compound Name | 2-(azetidin-2-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 70487851 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 2-(azetidin-2-yl)but-2-enoic acid |
| SMILES | CC=C(C(=O)O)C1CCN1 |
| InChI | InChI=1S/C7H11NO2/c1-2-5(7(9)10)6-3-4-8-6/h2,6,8H,3-4H2,1H3,(H,9,10) |
| InChIKey | GSDHHSKMDBEUHK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|