C19H24 — CID 53467222
[(4E)-1-cyclohexyl-3-methylhexa-1,2,4-trienyl]benzene (PubChem CID 53467222) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is [(4E)-1-cyclohexyl-3-methylhexa-1,2,4-trienyl]benzene.
| Compound Name | [(4E)-1-cyclohexyl-3-methylhexa-1,2,4-trienyl]benzene |
|---|---|
| PubChem CID | 53467222 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | [(4E)-1-cyclohexyl-3-methylhexa-1,2,4-trienyl]benzene |
| SMILES | C/C=C/C(C)=C=C(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C19H24/c1-3-10-16(2)15-19(17-11-6-4-7-12-17)18-13-8-5-9-14-18/h3-4,6-7,10-12,18H,5,8-9,13-14H2,1-2H3/b10-3+ |
| InChIKey | GJHFYCKWXMCPPE-XCVCLJGOSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|