C16H25IN2 — CID 74219724
[[cyclohexyl(phenyl)methylidene]amino]-trimethylazanium iodide (PubChem CID 74219724) has the molecular formula C16H25IN2 and a molecular weight of 372.29 g/mol. Its IUPAC name is [[cyclohexyl(phenyl)methylidene]amino]-trimethylazanium iodide.
| Compound Name | [[cyclohexyl(phenyl)methylidene]amino]-trimethylazanium iodide |
|---|---|
| PubChem CID | 74219724 |
| Molecular Formula | C16H25IN2 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [[cyclohexyl(phenyl)methylidene]amino]-trimethylazanium iodide |
| SMILES | C[N+](C)(C)N=C(c1ccccc1)C1CCCCC1.[I-] |
| InChI | InChI=1S/C16H25N2.HI/c1-18(2,3)17-16(14-10-6-4-7-11-14)15-12-8-5-9-13-15;/h4,6-7,10-11,15H,5,8-9,12-13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | IFZHHOPOIVATKY-UHFFFAOYSA-M |
| XLogP | 0.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|