C24H24N2O2 — CID 6109947
N-[(Z)-[cyclohexyl(phenyl)methylidene]amino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 6109947) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[(Z)-[cyclohexyl(phenyl)methylidene]amino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-[cyclohexyl(phenyl)methylidene]amino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 6109947 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[(Z)-[cyclohexyl(phenyl)methylidene]amino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | O=C(N/N=C(\c1ccccc1)C1CCCCC1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C24H24N2O2/c27-22-16-20-14-8-7-13-19(20)15-21(22)24(28)26-25-23(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1,3-4,7-10,13-16,18,27H,2,5-6,11-12H2,(H,26,28)/b25-23+ |
| InChIKey | HPPVJFODKDBOJX-WJTDDFOZSA-N |
| XLogP | 5.26 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|