C16H14N2O6 — CID 7789595
(2E)-2-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]pentanedioic acid (PubChem CID 7789595) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is (2E)-2-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]pentanedioic acid.
| Compound Name | (2E)-2-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]pentanedioic acid |
|---|---|
| PubChem CID | 7789595 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (2E)-2-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]pentanedioic acid |
| SMILES | O=C(O)CC/C(=N\NC(=O)c1cc2ccccc2cc1O)C(=O)O |
| InChI | InChI=1S/C16H14N2O6/c19-13-8-10-4-2-1-3-9(10)7-11(13)15(22)18-17-12(16(23)24)5-6-14(20)21/h1-4,7-8,19H,5-6H2,(H,18,22)(H,20,21)(H,23,24)/b17-12+ |
| InChIKey | QAQBPIRKEXIQAS-SFQUDFHCSA-N |
| XLogP | 1.58 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|