C21H18ClN3O3 — CID 17385865
N-[(E)-[4-(2-chloroanilino)-4-oxobutan-2-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 17385865) has the molecular formula C21H18ClN3O3 and a molecular weight of 395.85 g/mol. Its IUPAC name is N-[(E)-[4-(2-chloroanilino)-4-oxobutan-2-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(E)-[4-(2-chloroanilino)-4-oxobutan-2-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17385865 |
| Molecular Formula | C21H18ClN3O3 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | N-[(E)-[4-(2-chloroanilino)-4-oxobutan-2-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | C/C(CC(=O)Nc1ccccc1Cl)=N\NC(=O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C21H18ClN3O3/c1-13(10-20(27)23-18-9-5-4-8-17(18)22)24-25-21(28)16-11-14-6-2-3-7-15(14)12-19(16)26/h2-9,11-12,26H,10H2,1H3,(H,23,27)(H,25,28)/b24-13+ |
| InChIKey | VSVSGXAGLKBTDN-ZMOGYAJESA-N |
| XLogP | 4.33 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|