C17H14Cl3N3O3 — CID 3634372
5-chloro-N-[[4-(2,5-dichloroanilino)-4-oxobutan-2-ylidene]amino]-2-hydroxybenzamide (PubChem CID 3634372) has the molecular formula C17H14Cl3N3O3 and a molecular weight of 414.68 g/mol. Its IUPAC name is 5-chloro-N-[[4-(2,5-dichloroanilino)-4-oxobutan-2-ylidene]amino]-2-hydroxybenzamide.
| Compound Name | 5-chloro-N-[[4-(2,5-dichloroanilino)-4-oxobutan-2-ylidene]amino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 3634372 |
| Molecular Formula | C17H14Cl3N3O3 |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | 5-chloro-N-[[4-(2,5-dichloroanilino)-4-oxobutan-2-ylidene]amino]-2-hydroxybenzamide |
| SMILES | CC(CC(=O)Nc1cc(Cl)ccc1Cl)=NNC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H14Cl3N3O3/c1-9(6-16(25)21-14-8-11(19)2-4-13(14)20)22-23-17(26)12-7-10(18)3-5-15(12)24/h2-5,7-8,24H,6H2,1H3,(H,21,25)(H,23,26) |
| InChIKey | JLJMNKFDRQBSRY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|