C19H19Cl2N3O3 — CID 6016537
(3Z)-N-(2,5-dichlorophenyl)-3-[[2-(4-methoxyphenyl)acetyl]hydrazinylidene]butanamide (PubChem CID 6016537) has the molecular formula C19H19Cl2N3O3 and a molecular weight of 408.29 g/mol. Its IUPAC name is (3Z)-N-(2,5-dichlorophenyl)-3-[[2-(4-methoxyphenyl)acetyl]hydrazinylidene]butanamide.
| Compound Name | (3Z)-N-(2,5-dichlorophenyl)-3-[[2-(4-methoxyphenyl)acetyl]hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 6016537 |
| Molecular Formula | C19H19Cl2N3O3 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (3Z)-N-(2,5-dichlorophenyl)-3-[[2-(4-methoxyphenyl)acetyl]hydrazinylidene]butanamide |
| SMILES | COc1ccc(CC(=O)N/N=C(/C)CC(=O)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C19H19Cl2N3O3/c1-12(9-18(25)22-17-11-14(20)5-8-16(17)21)23-24-19(26)10-13-3-6-15(27-2)7-4-13/h3-8,11H,9-10H2,1-2H3,(H,22,25)(H,24,26)/b23-12- |
| InChIKey | WJLGCQSBFBPDJH-FMCGGJTJSA-N |
| XLogP | 4.07 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|