C17H17Cl2NO3S — CID 31089312
N-(2,5-dichlorophenyl)-2-[2-(4-methoxyphenoxy)ethylsulfanyl]acetamide (PubChem CID 31089312) has the molecular formula C17H17Cl2NO3S and a molecular weight of 386.30 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[2-(4-methoxyphenoxy)ethylsulfanyl]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[2-(4-methoxyphenoxy)ethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 31089312 |
| Molecular Formula | C17H17Cl2NO3S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[2-(4-methoxyphenoxy)ethylsulfanyl]acetamide |
| SMILES | COc1ccc(OCCSCC(=O)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2NO3S/c1-22-13-3-5-14(6-4-13)23-8-9-24-11-17(21)20-16-10-12(18)2-7-15(16)19/h2-7,10H,8-9,11H2,1H3,(H,20,21) |
| InChIKey | OXRRRECKXWFEDF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|