C21H27NO5S — CID 31547774
N-(2,5-dimethoxyphenyl)-2-[2-(4-propoxyphenoxy)ethylsulfanyl]acetamide (PubChem CID 31547774) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-[2-(4-propoxyphenoxy)ethylsulfanyl]acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-[2-(4-propoxyphenoxy)ethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 31547774 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-[2-(4-propoxyphenoxy)ethylsulfanyl]acetamide |
| SMILES | CCCOc1ccc(OCCSCC(=O)Nc2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C21H27NO5S/c1-4-11-26-16-5-7-17(8-6-16)27-12-13-28-15-21(23)22-19-14-18(24-2)9-10-20(19)25-3/h5-10,14H,4,11-13,15H2,1-3H3,(H,22,23) |
| InChIKey | CFHZLRYOVFNSBT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|