C20H25NO5S — CID 31544280
N-(2,5-dimethoxyphenyl)-2-[2-(4-ethoxyphenoxy)ethylsulfanyl]acetamide (PubChem CID 31544280) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-[2-(4-ethoxyphenoxy)ethylsulfanyl]acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-[2-(4-ethoxyphenoxy)ethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 31544280 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-[2-(4-ethoxyphenoxy)ethylsulfanyl]acetamide |
| SMILES | CCOc1ccc(OCCSCC(=O)Nc2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C20H25NO5S/c1-4-25-15-5-7-16(8-6-15)26-11-12-27-14-20(22)21-18-13-17(23-2)9-10-19(18)24-3/h5-10,13H,4,11-12,14H2,1-3H3,(H,21,22) |
| InChIKey | BKMQVXYWWANEAB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|