C18H20INO3S — CID 42998398
2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-(2-iodophenyl)acetamide (PubChem CID 42998398) has the molecular formula C18H20INO3S and a molecular weight of 457.33 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-(2-iodophenyl)acetamide.
| Compound Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 42998398 |
| Molecular Formula | C18H20INO3S |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-N-(2-iodophenyl)acetamide |
| SMILES | CCOc1ccc(OCCSCC(=O)Nc2ccccc2I)cc1 |
| InChI | InChI=1S/C18H20INO3S/c1-2-22-14-7-9-15(10-8-14)23-11-12-24-13-18(21)20-17-6-4-3-5-16(17)19/h3-10H,2,11-13H2,1H3,(H,20,21) |
| InChIKey | QNGKPXBCIHPINL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|