C36H39N3O4 — CID 98296801
N-[(E)-[(5S)-9-(dibenzylamino)-5-ethyl-6,9-dioxononan-4-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 98296801) has the molecular formula C36H39N3O4 and a molecular weight of 577.73 g/mol. Its IUPAC name is N-[(E)-[(5S)-9-(dibenzylamino)-5-ethyl-6,9-dioxononan-4-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(E)-[(5S)-9-(dibenzylamino)-5-ethyl-6,9-dioxononan-4-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 98296801 |
| Molecular Formula | C36H39N3O4 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | N-[(E)-[(5S)-9-(dibenzylamino)-5-ethyl-6,9-dioxononan-4-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | CCC/C(=N\NC(=O)c1cc2ccccc2cc1O)C(CC)C(=O)CCC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C36H39N3O4/c1-3-13-32(37-38-36(43)31-22-28-18-11-12-19-29(28)23-34(31)41)30(4-2)33(40)20-21-35(42)39(24-26-14-7-5-8-15-26)25-27-16-9-6-10-17-27/h5-12,14-19,22-23,30,41H,3-4,13,20-21,24-25H2,1-2H3,(H,38,43)/b37-32+ |
| InChIKey | FOVNXGUJLKOQDP-BQNXFWFHSA-N |
| XLogP | 7.04 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|