C37H41N3O4 — CID 6070167
N-[(E)-[1-(dibenzylamino)-1,6-dioxododecan-4-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 6070167) has the molecular formula C37H41N3O4 and a molecular weight of 591.75 g/mol. Its IUPAC name is N-[(E)-[1-(dibenzylamino)-1,6-dioxododecan-4-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(E)-[1-(dibenzylamino)-1,6-dioxododecan-4-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 6070167 |
| Molecular Formula | C37H41N3O4 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | N-[(E)-[1-(dibenzylamino)-1,6-dioxododecan-4-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | CCCCCCC(=O)C/C(CCC(=O)N(Cc1ccccc1)Cc1ccccc1)=N/NC(=O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C37H41N3O4/c1-2-3-4-11-20-33(41)25-32(38-39-37(44)34-23-30-18-12-13-19-31(30)24-35(34)42)21-22-36(43)40(26-28-14-7-5-8-15-28)27-29-16-9-6-10-17-29/h5-10,12-19,23-24,42H,2-4,11,20-22,25-27H2,1H3,(H,39,44)/b38-32+ |
| InChIKey | OSRJTODEHBYVPE-WAQNPYFYSA-N |
| XLogP | 7.57 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|