C33H35N3O4 — CID 5388125
N-[(E)-[1-(dibutylamino)-4-naphthalen-1-yl-1,4-dioxobutan-2-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 5388125) has the molecular formula C33H35N3O4 and a molecular weight of 537.66 g/mol. Its IUPAC name is N-[(E)-[1-(dibutylamino)-4-naphthalen-1-yl-1,4-dioxobutan-2-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(E)-[1-(dibutylamino)-4-naphthalen-1-yl-1,4-dioxobutan-2-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 5388125 |
| Molecular Formula | C33H35N3O4 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | N-[(E)-[1-(dibutylamino)-4-naphthalen-1-yl-1,4-dioxobutan-2-ylidene]amino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)/C(CC(=O)c1cccc2ccccc12)=N/NC(=O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C33H35N3O4/c1-3-5-18-36(19-6-4-2)33(40)29(22-31(38)27-17-11-15-23-12-9-10-16-26(23)27)34-35-32(39)28-20-24-13-7-8-14-25(24)21-30(28)37/h7-17,20-21,37H,3-6,18-19,22H2,1-2H3,(H,35,39)/b34-29+ |
| InChIKey | FDLFVZXEYNUZQG-RIHQVDFKSA-N |
| XLogP | 6.49 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|