C16H12N2O6-2 — CID 54697775
(4E)-5-hydroxy-4-[(3-oxidonaphthalene-2-carbonyl)hydrazinylidene]-5-oxopentanoate (PubChem CID 54697775) has the molecular formula C16H12N2O6-2 and a molecular weight of 328.28 g/mol. Its IUPAC name is (4E)-5-hydroxy-4-[(3-oxidonaphthalene-2-carbonyl)hydrazinylidene]-5-oxopentanoate.
| Compound Name | (4E)-5-hydroxy-4-[(3-oxidonaphthalene-2-carbonyl)hydrazinylidene]-5-oxopentanoate |
|---|---|
| PubChem CID | 54697775 |
| Molecular Formula | C16H12N2O6-2 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (4E)-5-hydroxy-4-[(3-oxidonaphthalene-2-carbonyl)hydrazinylidene]-5-oxopentanoate |
| SMILES | O=C([O-])CC/C(=N\NC(=O)c1cc2ccccc2cc1[O-])C(=O)O |
| InChI | InChI=1S/C16H14N2O6/c19-13-8-10-4-2-1-3-9(10)7-11(13)15(22)18-17-12(16(23)24)5-6-14(20)21/h1-4,7-8,19H,5-6H2,(H,18,22)(H,20,21)(H,23,24)/p-2/b17-12+ |
| InChIKey | QAQBPIRKEXIQAS-SFQUDFHCSA-L |
| XLogP | -0.39 |
| TPSA | 141.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|